Epoxy compounds usually have stronger nucleophilic ability, because the alkyl group on the oxygen atom makes the bond angle smaller, which makes the lone pair of electrons react more dissimilarly with the electron-deficient system. Compound: 2-Chloropyridine 1-oxide, is researched, Molecular C5H4ClNO, CAS is 2402-95-1, about Synthesis of 2-chloropyridine-n-oxide on supported phosphotungstic acid catalyst.Application In Synthesis of 2-Chloropyridine 1-oxide.
Phosphotungstic acid immobilized on silicon dioxide is prepared as catalyst. 2-Chloropyridine-N-oxide is synthesized from 2-chloropyridine, H2O2 and catalyst. By single factor experiment, effects of mass fraction of phosphotungstic acid, catalyst dosage, molar ratio of reactants, reaction temperature and reaction time on oxidation is studied. Through repeat examinations, the optimal reaction conditions is mass fraction of phosphotungstic acid 30%, mass of catalyst 3.3%; n(2-chloropyridine):n(H2O2)=1:6.0; reaction temperature 80°C and reaction time 30 h. The optimal yield is 89.8%.
There is still a lot of research devoted to this compound(SMILES：ClC1=CC=CC=[N+]1[O-])Application In Synthesis of 2-Chloropyridine 1-oxide, and with the development of science, more effects of this compound(2402-95-1) can be discovered.
Reference:
Isoxazole – Wikipedia,
Isoxazole | C3H3NO – PubChem